C28H22F3N3O3 — CID 58595389
(6R,7R)-8-(2,2-diphenylacetyl)-4-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 58595389) has the molecular formula C28H22F3N3O3 and a molecular weight of 505.50 g/mol. Its IUPAC name is (6R,7R)-8-(2,2-diphenylacetyl)-4-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (6R,7R)-8-(2,2-diphenylacetyl)-4-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 58595389 |
| Molecular Formula | C28H22F3N3O3 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | (6R,7R)-8-(2,2-diphenylacetyl)-4-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@H]2[C@H]3CC(CN3C(=O)C(c3ccccc3)c3ccccc3)N2C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H22F3N3O3/c29-28(30,31)19-12-7-13-20(14-19)34-26(36)24-22-15-21(33(24)27(34)37)16-32(22)25(35)23(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-14,21-24H,15-16H2/t21?,22-,24-/m1/s1 |
| InChIKey | XSEHVHSWEYFQCG-YUWPFLFCSA-N |
| XLogP | 4.66 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|