C22H16F3N5O3 — CID 71051682
5-[(1R,6S)-3,5-dioxo-8-[2-(trifluoromethyl)benzoyl]-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylpyridine-2-carbonitrile (PubChem CID 71051682) has the molecular formula C22H16F3N5O3 and a molecular weight of 455.40 g/mol. Its IUPAC name is 5-[(1R,6S)-3,5-dioxo-8-[2-(trifluoromethyl)benzoyl]-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylpyridine-2-carbonitrile.
| Compound Name | 5-[(1R,6S)-3,5-dioxo-8-[2-(trifluoromethyl)benzoyl]-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 71051682 |
| Molecular Formula | C22H16F3N5O3 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 5-[(1R,6S)-3,5-dioxo-8-[2-(trifluoromethyl)benzoyl]-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylpyridine-2-carbonitrile |
| SMILES | Cc1cc(N2C(=O)[C@@H]3C4C[C@H](CN4C(=O)c4ccccc4C(F)(F)F)N3C2=O)cnc1C#N |
| InChI | InChI=1S/C22H16F3N5O3/c1-11-6-12(9-27-16(11)8-26)30-20(32)18-17-7-13(29(18)21(30)33)10-28(17)19(31)14-4-2-3-5-15(14)22(23,24)25/h2-6,9,13,17-18H,7,10H2,1H3/t13-,17?,18+/m1/s1 |
| InChIKey | YCJUUTJMNLIICD-ODPJWBIYSA-N |
| XLogP | 2.71 |
| TPSA | 97.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|