C23H25N7O3 — CID 71051680
5-[(1R,6S)-8-(3-tert-butyl-1-methylpyrazole-5-carbonyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylpyridine-2-carbonitrile (PubChem CID 71051680) has the molecular formula C23H25N7O3 and a molecular weight of 447.50 g/mol. Its IUPAC name is 5-[(1R,6S)-8-(3-tert-butyl-1-methylpyrazole-5-carbonyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylpyridine-2-carbonitrile.
| Compound Name | 5-[(1R,6S)-8-(3-tert-butyl-1-methylpyrazole-5-carbonyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 71051680 |
| Molecular Formula | C23H25N7O3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 5-[(1R,6S)-8-(3-tert-butyl-1-methylpyrazole-5-carbonyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylpyridine-2-carbonitrile |
| SMILES | Cc1cc(N2C(=O)[C@@H]3C4C[C@H](CN4C(=O)c4cc(C(C)(C)C)nn4C)N3C2=O)cnc1C#N |
| InChI | InChI=1S/C23H25N7O3/c1-12-6-13(10-25-15(12)9-24)30-21(32)19-16-7-14(29(19)22(30)33)11-28(16)20(31)17-8-18(23(2,3)4)26-27(17)5/h6,8,10,14,16,19H,7,11H2,1-5H3/t14-,16?,19+/m1/s1 |
| InChIKey | WTIHOVDYPQFAFN-QWNRATHESA-N |
| XLogP | 1.73 |
| TPSA | 115.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|