C26H26N7O3+ — CID 87982932
4-[9-(3-tert-butyl-1-methylpyrazole-5-carbonyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]isoquinoline-1-carbonitrile (PubChem CID 87982932) has the molecular formula C26H26N7O3+ and a molecular weight of 484.54 g/mol. Its IUPAC name is 4-[9-(3-tert-butyl-1-methylpyrazole-5-carbonyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]isoquinoline-1-carbonitrile.
| Compound Name | 4-[9-(3-tert-butyl-1-methylpyrazole-5-carbonyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]isoquinoline-1-carbonitrile |
|---|---|
| PubChem CID | 87982932 |
| Molecular Formula | C26H26N7O3+ |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 4-[9-(3-tert-butyl-1-methylpyrazole-5-carbonyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]isoquinoline-1-carbonitrile |
| SMILES | Cn1nc(C(C)(C)C)cc1C(=O)C1CN2CC3C(=O)N(c4cnc(C#N)c5ccccc45)C(=O)[N+]13C2 |
| InChI | InChI=1S/C26H26N7O3/c1-26(2,3)22-9-18(30(4)29-22)23(34)20-12-31-13-21-24(35)32(25(36)33(20,21)14-31)19-11-28-17(10-27)15-7-5-6-8-16(15)19/h5-9,11,20-21H,12-14H2,1-4H3/q+1 |
| InChIKey | HIWDAGVKBWLCDC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 112.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|