C28H27N6O4S+ — CID 87982967
3-(1-cyanoisoquinolin-4-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carbothioamide (PubChem CID 87982967) has the molecular formula C28H27N6O4S+ and a molecular weight of 543.63 g/mol. Its IUPAC name is 3-(1-cyanoisoquinolin-4-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carbothioamide.
| Compound Name | 3-(1-cyanoisoquinolin-4-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carbothioamide |
|---|---|
| PubChem CID | 87982967 |
| Molecular Formula | C28H27N6O4S+ |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 3-(1-cyanoisoquinolin-4-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carbothioamide |
| SMILES | COc1ccc(CCNC(=S)C2CN3CC4C(=O)N(c5cnc(C#N)c6ccccc56)C(=O)[N+]42C3)cc1OC |
| InChI | InChI=1S/C28H26N6O4S/c1-37-24-8-7-17(11-25(24)38-2)9-10-30-26(39)22-14-32-15-23-27(35)33(28(36)34(22,23)16-32)21-13-31-20(12-29)18-5-3-4-6-19(18)21/h3-8,11,13,22-23H,9-10,14-16H2,1-2H3/p+1 |
| InChIKey | DHYMVCBUNCGZHK-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|