C24H16F2N5O3+ — CID 87982936
4-[9-(3,5-difluorobenzoyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]isoquinoline-1-carbonitrile (PubChem CID 87982936) has the molecular formula C24H16F2N5O3+ and a molecular weight of 460.42 g/mol. Its IUPAC name is 4-[9-(3,5-difluorobenzoyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]isoquinoline-1-carbonitrile.
| Compound Name | 4-[9-(3,5-difluorobenzoyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]isoquinoline-1-carbonitrile |
|---|---|
| PubChem CID | 87982936 |
| Molecular Formula | C24H16F2N5O3+ |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 4-[9-(3,5-difluorobenzoyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]isoquinoline-1-carbonitrile |
| SMILES | N#Cc1ncc(N2C(=O)C3CN4CC(C(=O)c5cc(F)cc(F)c5)[N+]3(C4)C2=O)c2ccccc12 |
| InChI | InChI=1S/C24H16F2N5O3/c25-14-5-13(6-15(26)7-14)22(32)20-10-29-11-21-23(33)30(24(34)31(20,21)12-29)19-9-28-18(8-27)16-3-1-2-4-17(16)19/h1-7,9,20-21H,10-12H2/q+1 |
| InChIKey | AQPKCFSRYNKDDW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 94.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|