C20H16F3N4O4S+ — CID 87779757
4-[2,4-dioxo-9-(2,2,2-trifluoroethylsulfonyl)-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]naphthalene-1-carbonitrile (PubChem CID 87779757) has the molecular formula C20H16F3N4O4S+ and a molecular weight of 465.43 g/mol. Its IUPAC name is 4-[2,4-dioxo-9-(2,2,2-trifluoroethylsulfonyl)-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[2,4-dioxo-9-(2,2,2-trifluoroethylsulfonyl)-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 87779757 |
| Molecular Formula | C20H16F3N4O4S+ |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 4-[2,4-dioxo-9-(2,2,2-trifluoroethylsulfonyl)-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]naphthalene-1-carbonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C3CN4CC(S(=O)(=O)CC(F)(F)F)[N+]3(C4)C2=O)c2ccccc12 |
| InChI | InChI=1S/C20H16F3N4O4S/c21-20(22,23)10-32(30,31)17-9-25-8-16-18(28)26(19(29)27(16,17)11-25)15-6-5-12(7-24)13-3-1-2-4-14(13)15/h1-6,16-17H,8-11H2/q+1 |
| InChIKey | BMEWJMXNMIOXNP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|