C19H16F3N6O4S+ — CID 87778100
4-[9-(1-methylimidazol-4-yl)sulfonyl-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 87778100) has the molecular formula C19H16F3N6O4S+ and a molecular weight of 481.44 g/mol. Its IUPAC name is 4-[9-(1-methylimidazol-4-yl)sulfonyl-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[9-(1-methylimidazol-4-yl)sulfonyl-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 87778100 |
| Molecular Formula | C19H16F3N6O4S+ |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 4-[9-(1-methylimidazol-4-yl)sulfonyl-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | Cn1cnc(S(=O)(=O)C2CN3CC4C(=O)N(c5ccc(C#N)c(C(F)(F)F)c5)C(=O)[N+]42C3)c1 |
| InChI | InChI=1S/C19H16F3N6O4S/c1-25-7-15(24-9-25)33(31,32)16-8-26-6-14-17(29)27(18(30)28(14,16)10-26)12-3-2-11(5-23)13(4-12)19(20,21)22/h2-4,7,9,14,16H,6,8,10H2,1H3/q+1 |
| InChIKey | ISEYKSQWACTSDV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 116.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|