C19H15N4O4+ — CID 87613408
3-(4-cyanonaphthalen-1-yl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carboxylic acid (PubChem CID 87613408) has the molecular formula C19H15N4O4+ and a molecular weight of 363.35 g/mol. Its IUPAC name is 3-(4-cyanonaphthalen-1-yl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carboxylic acid.
| Compound Name | 3-(4-cyanonaphthalen-1-yl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carboxylic acid |
|---|---|
| PubChem CID | 87613408 |
| Molecular Formula | C19H15N4O4+ |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 3-(4-cyanonaphthalen-1-yl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carboxylic acid |
| SMILES | N#Cc1ccc(N2C(=O)C3CN4CC(C(=O)O)[N+]3(C4)C2=O)c2ccccc12 |
| InChI | InChI=1S/C19H14N4O4/c20-7-11-5-6-14(13-4-2-1-3-12(11)13)22-17(24)15-8-21-9-16(18(25)26)23(15,10-21)19(22)27/h1-6,15-16H,8-10H2/p+1 |
| InChIKey | DCLKBHHHKJPIRX-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|