C22H25ClN5O5+ — CID 87983635
(2S,3S)-2-[[3-(3-chloro-4-cyano-2-methylphenyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carbonyl]amino]-3-methylpentanoic acid (PubChem CID 87983635) has the molecular formula C22H25ClN5O5+ and a molecular weight of 474.93 g/mol. Its IUPAC name is (2S,3S)-2-[[3-(3-chloro-4-cyano-2-methylphenyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carbonyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[3-(3-chloro-4-cyano-2-methylphenyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carbonyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 87983635 |
| Molecular Formula | C22H25ClN5O5+ |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (2S,3S)-2-[[3-(3-chloro-4-cyano-2-methylphenyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carbonyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)C1CN2CC3C(=O)N(c4ccc(C#N)c(Cl)c4C)C(=O)[N+]13C2)C(=O)O |
| InChI | InChI=1S/C22H24ClN5O5/c1-4-11(2)18(21(31)32)25-19(29)15-8-26-9-16-20(30)27(22(33)28(15,16)10-26)14-6-5-13(7-24)17(23)12(14)3/h5-6,11,15-16,18H,4,8-10H2,1-3H3,(H-,25,29,31,32)/p+1/t11-,15?,16?,18-,28?/m0/s1 |
| InChIKey | NCYURGBBJQYHHW-PQMFRJLCSA-O |
| XLogP | 1.44 |
| TPSA | 130.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|