C29H25ClN5O3+ — CID 87982928
4-[9-[1-(4-chlorophenyl)cyclopentanecarbonyl]-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]isoquinoline-1-carbonitrile (PubChem CID 87982928) has the molecular formula C29H25ClN5O3+ and a molecular weight of 527.00 g/mol. Its IUPAC name is 4-[9-[1-(4-chlorophenyl)cyclopentanecarbonyl]-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]isoquinoline-1-carbonitrile.
| Compound Name | 4-[9-[1-(4-chlorophenyl)cyclopentanecarbonyl]-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]isoquinoline-1-carbonitrile |
|---|---|
| PubChem CID | 87982928 |
| Molecular Formula | C29H25ClN5O3+ |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 4-[9-[1-(4-chlorophenyl)cyclopentanecarbonyl]-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]isoquinoline-1-carbonitrile |
| SMILES | N#Cc1ncc(N2C(=O)C3CN4CC(C(=O)C5(c6ccc(Cl)cc6)CCCC5)[N+]3(C4)C2=O)c2ccccc12 |
| InChI | InChI=1S/C29H25ClN5O3/c30-19-9-7-18(8-10-19)29(11-3-4-12-29)26(36)24-15-33-16-25-27(37)34(28(38)35(24,25)17-33)23-14-32-22(13-31)20-5-1-2-6-21(20)23/h1-2,5-10,14,24-25H,3-4,11-12,15-17H2/q+1 |
| InChIKey | FYWXSNHXHVUUHE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 94.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|