C21H23ClFN3O2 — CID 122258384
[1-(4-chlorophenyl)cyclopentyl]-[3-(5-fluoropyrimidin-2-yl)oxypiperidin-1-yl]methanone (PubChem CID 122258384) has the molecular formula C21H23ClFN3O2 and a molecular weight of 403.89 g/mol. Its IUPAC name is [1-(4-chlorophenyl)cyclopentyl]-[3-(5-fluoropyrimidin-2-yl)oxypiperidin-1-yl]methanone.
| Compound Name | [1-(4-chlorophenyl)cyclopentyl]-[3-(5-fluoropyrimidin-2-yl)oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 122258384 |
| Molecular Formula | C21H23ClFN3O2 |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [1-(4-chlorophenyl)cyclopentyl]-[3-(5-fluoropyrimidin-2-yl)oxypiperidin-1-yl]methanone |
| SMILES | O=C(N1CCCC(Oc2ncc(F)cn2)C1)C1(c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C21H23ClFN3O2/c22-16-7-5-15(6-8-16)21(9-1-2-10-21)19(27)26-11-3-4-18(14-26)28-20-24-12-17(23)13-25-20/h5-8,12-13,18H,1-4,9-11,14H2 |
| InChIKey | BETNUPHUIJFILG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |