C18H18ClF2N3O2 — CID 122267241
3-(3-chloro-4-fluorophenyl)-1-[3-(5-fluoropyrimidin-2-yl)oxypiperidin-1-yl]propan-1-one (PubChem CID 122267241) has the molecular formula C18H18ClF2N3O2 and a molecular weight of 381.81 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-[3-(5-fluoropyrimidin-2-yl)oxypiperidin-1-yl]propan-1-one.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-[3-(5-fluoropyrimidin-2-yl)oxypiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 122267241 |
| Molecular Formula | C18H18ClF2N3O2 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-[3-(5-fluoropyrimidin-2-yl)oxypiperidin-1-yl]propan-1-one |
| SMILES | O=C(CCc1ccc(F)c(Cl)c1)N1CCCC(Oc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C18H18ClF2N3O2/c19-15-8-12(3-5-16(15)21)4-6-17(25)24-7-1-2-14(11-24)26-18-22-9-13(20)10-23-18/h3,5,8-10,14H,1-2,4,6-7,11H2 |
| InChIKey | HWQNBEQINSQRBP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |