C12H15Cl2N3O2 — CID 122259293
3-chloro-1-[3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]propan-1-one (PubChem CID 122259293) has the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.18 g/mol. Its IUPAC name is 3-chloro-1-[3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]propan-1-one.
| Compound Name | 3-chloro-1-[3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 122259293 |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 3-chloro-1-[3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]propan-1-one |
| SMILES | O=C(CCCl)N1CCCC(Oc2ncc(Cl)cn2)C1 |
| InChI | InChI=1S/C12H15Cl2N3O2/c13-4-3-11(18)17-5-1-2-10(8-17)19-12-15-6-9(14)7-16-12/h6-7,10H,1-5,8H2 |
| InChIKey | KIVRZMZGQOEYAE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|