C13H17ClN4O2 — CID 122259581
3-(5-chloropyrimidin-2-yl)oxy-N-prop-2-enylpiperidine-1-carboxamide (PubChem CID 122259581) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is 3-(5-chloropyrimidin-2-yl)oxy-N-prop-2-enylpiperidine-1-carboxamide.
| Compound Name | 3-(5-chloropyrimidin-2-yl)oxy-N-prop-2-enylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 122259581 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-(5-chloropyrimidin-2-yl)oxy-N-prop-2-enylpiperidine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCCC(Oc2ncc(Cl)cn2)C1 |
| InChI | InChI=1S/C13H17ClN4O2/c1-2-5-15-13(19)18-6-3-4-11(9-18)20-12-16-7-10(14)8-17-12/h2,7-8,11H,1,3-6,9H2,(H,15,19) |
| InChIKey | JPSVPTNVOVRNNY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|