C25H28N7O3S+ — CID 87982929
3-(8-cyanoquinolin-5-yl)-N-(3-morpholin-4-ylpropyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carbothioamide (PubChem CID 87982929) has the molecular formula C25H28N7O3S+ and a molecular weight of 506.61 g/mol. Its IUPAC name is 3-(8-cyanoquinolin-5-yl)-N-(3-morpholin-4-ylpropyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carbothioamide.
| Compound Name | 3-(8-cyanoquinolin-5-yl)-N-(3-morpholin-4-ylpropyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carbothioamide |
|---|---|
| PubChem CID | 87982929 |
| Molecular Formula | C25H28N7O3S+ |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 3-(8-cyanoquinolin-5-yl)-N-(3-morpholin-4-ylpropyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-9-carbothioamide |
| SMILES | N#Cc1ccc(N2C(=O)C3CN4CC(C(=S)NCCCN5CCOCC5)[N+]3(C4)C2=O)c2cccnc12 |
| InChI | InChI=1S/C25H27N7O3S/c26-13-17-4-5-19(18-3-1-6-27-22(17)18)31-24(33)21-15-30-14-20(32(21,16-30)25(31)34)23(36)28-7-2-8-29-9-11-35-12-10-29/h1,3-6,20-21H,2,7-12,14-16H2/p+1 |
| InChIKey | ZBSKUGNYTJLZKO-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|