C30H21N5O3 — CID 69306588
4-[(1S,6S,7S)-3,5-dioxo-8-(4-phenylbenzoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]isoquinoline-1-carbonitrile (PubChem CID 69306588) has the molecular formula C30H21N5O3 and a molecular weight of 499.53 g/mol. Its IUPAC name is 4-[(1S,6S,7S)-3,5-dioxo-8-(4-phenylbenzoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]isoquinoline-1-carbonitrile.
| Compound Name | 4-[(1S,6S,7S)-3,5-dioxo-8-(4-phenylbenzoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]isoquinoline-1-carbonitrile |
|---|---|
| PubChem CID | 69306588 |
| Molecular Formula | C30H21N5O3 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 4-[(1S,6S,7S)-3,5-dioxo-8-(4-phenylbenzoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]isoquinoline-1-carbonitrile |
| SMILES | N#Cc1ncc(N2C(=O)[C@@H]3[C@@H]4C[C@@H](CN4C(=O)c4ccc(-c5ccccc5)cc4)N3C2=O)c2ccccc12 |
| InChI | InChI=1S/C30H21N5O3/c31-15-24-22-8-4-5-9-23(22)26(16-32-24)35-29(37)27-25-14-21(34(27)30(35)38)17-33(25)28(36)20-12-10-19(11-13-20)18-6-2-1-3-7-18/h1-13,16,21,25,27H,14,17H2/t21-,25-,27-/m0/s1 |
| InChIKey | BKBPUDSMGVCNBG-NOOLENRPSA-N |
| XLogP | 4.21 |
| TPSA | 97.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|