C21H16N6O2S — CID 89226649
(1R,6S)-4-(1-cyanoisoquinolin-4-yl)-3,5-dioxo-N-prop-2-ynyl-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide (PubChem CID 89226649) has the molecular formula C21H16N6O2S and a molecular weight of 416.47 g/mol. Its IUPAC name is (1R,6S)-4-(1-cyanoisoquinolin-4-yl)-3,5-dioxo-N-prop-2-ynyl-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide.
| Compound Name | (1R,6S)-4-(1-cyanoisoquinolin-4-yl)-3,5-dioxo-N-prop-2-ynyl-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide |
|---|---|
| PubChem CID | 89226649 |
| Molecular Formula | C21H16N6O2S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | (1R,6S)-4-(1-cyanoisoquinolin-4-yl)-3,5-dioxo-N-prop-2-ynyl-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide |
| SMILES | C#CCNC(=S)N1C[C@H]2CC1[C@H]1C(=O)N(c3cnc(C#N)c4ccccc34)C(=O)N21 |
| InChI | InChI=1S/C21H16N6O2S/c1-2-7-23-20(30)25-11-12-8-16(25)18-19(28)27(21(29)26(12)18)17-10-24-15(9-22)13-5-3-4-6-14(13)17/h1,3-6,10,12,16,18H,7-8,11H2,(H,23,30)/t12-,16?,18+/m1/s1 |
| InChIKey | SCVUDNVUGNAWHW-ZAYVCONHSA-N |
| XLogP | 1.21 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|