C21H19N5O4 — CID 71051609
propan-2-yl (1R,6S)-4-(1-cyanoisoquinolin-4-yl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 71051609) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is propan-2-yl (1R,6S)-4-(1-cyanoisoquinolin-4-yl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | propan-2-yl (1R,6S)-4-(1-cyanoisoquinolin-4-yl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 71051609 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | propan-2-yl (1R,6S)-4-(1-cyanoisoquinolin-4-yl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | CC(C)OC(=O)N1C[C@H]2CC1[C@H]1C(=O)N(c3cnc(C#N)c4ccccc34)C(=O)N21 |
| InChI | InChI=1S/C21H19N5O4/c1-11(2)30-21(29)24-10-12-7-16(24)18-19(27)26(20(28)25(12)18)17-9-23-15(8-22)13-5-3-4-6-14(13)17/h3-6,9,11-12,16,18H,7,10H2,1-2H3/t12-,16?,18+/m1/s1 |
| InChIKey | QWSFPXXRFUUEHK-ZAYVCONHSA-N |
| XLogP | 2.25 |
| TPSA | 106.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|