C21H16F2N5O3+ — CID 87983654
5-[9-(3,5-difluorobenzoyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]-3-methylpyridine-2-carbonitrile (PubChem CID 87983654) has the molecular formula C21H16F2N5O3+ and a molecular weight of 424.39 g/mol. Its IUPAC name is 5-[9-(3,5-difluorobenzoyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]-3-methylpyridine-2-carbonitrile.
| Compound Name | 5-[9-(3,5-difluorobenzoyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]-3-methylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 87983654 |
| Molecular Formula | C21H16F2N5O3+ |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 5-[9-(3,5-difluorobenzoyl)-2,4-dioxo-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decan-3-yl]-3-methylpyridine-2-carbonitrile |
| SMILES | Cc1cc(N2C(=O)C3CN4CC(C(=O)c5cc(F)cc(F)c5)[N+]3(C4)C2=O)cnc1C#N |
| InChI | InChI=1S/C21H16F2N5O3/c1-11-2-15(7-25-16(11)6-24)27-20(30)18-9-26-8-17(28(18,10-26)21(27)31)19(29)12-3-13(22)5-14(23)4-12/h2-5,7,17-18H,8-10H2,1H3/q+1 |
| InChIKey | SWUVEVXZZLMHKI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 94.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|