C23H20F3N5O3 — CID 142258523
5-[(5R,8S,8aS)-5,8-dimethyl-1,3-dioxo-7-[2-(trifluoromethyl)benzoyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-3-methylpyridine-2-carbonitrile (PubChem CID 142258523) has the molecular formula C23H20F3N5O3 and a molecular weight of 471.44 g/mol. Its IUPAC name is 5-[(5R,8S,8aS)-5,8-dimethyl-1,3-dioxo-7-[2-(trifluoromethyl)benzoyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-3-methylpyridine-2-carbonitrile.
| Compound Name | 5-[(5R,8S,8aS)-5,8-dimethyl-1,3-dioxo-7-[2-(trifluoromethyl)benzoyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-3-methylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 142258523 |
| Molecular Formula | C23H20F3N5O3 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 5-[(5R,8S,8aS)-5,8-dimethyl-1,3-dioxo-7-[2-(trifluoromethyl)benzoyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-3-methylpyridine-2-carbonitrile |
| SMILES | Cc1cc(N2C(=O)[C@@H]3[C@H](C)N(C(=O)c4ccccc4C(F)(F)F)C[C@@H](C)N3C2=O)cnc1C#N |
| InChI | InChI=1S/C23H20F3N5O3/c1-12-8-15(10-28-18(12)9-27)31-21(33)19-14(3)29(11-13(2)30(19)22(31)34)20(32)16-6-4-5-7-17(16)23(24,25)26/h4-8,10,13-14,19H,11H2,1-3H3/t13-,14+,19+/m1/s1 |
| InChIKey | PRXWKMDSINYXQI-TYILLQQXSA-N |
| XLogP | 3.35 |
| TPSA | 97.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|