C21H23F3N4O4 — CID 171322329
(6-amino-3-pyridinyl)-[(2R,3R)-2,3-dimethyl-4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone;formic acid (PubChem CID 171322329) has the molecular formula C21H23F3N4O4 and a molecular weight of 452.43 g/mol. Its IUPAC name is (6-amino-3-pyridinyl)-[(2R,3R)-2,3-dimethyl-4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone;formic acid.
| Compound Name | (6-amino-3-pyridinyl)-[(2R,3R)-2,3-dimethyl-4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 171322329 |
| Molecular Formula | C21H23F3N4O4 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (6-amino-3-pyridinyl)-[(2R,3R)-2,3-dimethyl-4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone;formic acid |
| SMILES | C[C@@H]1[C@@H](C)N(C(=O)c2ccccc2C(F)(F)F)CCN1C(=O)c1ccc(N)nc1.O=CO |
| InChI | InChI=1S/C20H21F3N4O2.CH2O2/c1-12-13(2)27(19(29)15-5-3-4-6-16(15)20(21,22)23)10-9-26(12)18(28)14-7-8-17(24)25-11-14;2-1-3/h3-8,11-13H,9-10H2,1-2H3,(H2,24,25);1H,(H,2,3)/t12-,13-;/m1./s1 |
| InChIKey | UFXOBRABXVYMJO-OJERSXHUSA-N |
| XLogP | 2.76 |
| TPSA | 116.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|