C14H11F3O2 — CID 150576396
1-cyclopropyl-4-[2-(trifluoromethyl)phenyl]but-2-ene-1,4-dione (PubChem CID 150576396) has the molecular formula C14H11F3O2 and a molecular weight of 268.23 g/mol. Its IUPAC name is 1-cyclopropyl-4-[2-(trifluoromethyl)phenyl]but-2-ene-1,4-dione.
| Compound Name | 1-cyclopropyl-4-[2-(trifluoromethyl)phenyl]but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 150576396 |
| Molecular Formula | C14H11F3O2 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-cyclopropyl-4-[2-(trifluoromethyl)phenyl]but-2-ene-1,4-dione |
| SMILES | O=C(C=CC(=O)C1CC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H11F3O2/c15-14(16,17)11-4-2-1-3-10(11)13(19)8-7-12(18)9-5-6-9/h1-4,7-9H,5-6H2 |
| InChIKey | IMXGJSHZSGMQSP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|