C17H15F3O — CID 163447349
(E)-3-(4-methylcyclohexa-1,5-dien-1-yl)-1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 163447349) has the molecular formula C17H15F3O and a molecular weight of 292.30 g/mol. Its IUPAC name is (E)-3-(4-methylcyclohexa-1,5-dien-1-yl)-1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-methylcyclohexa-1,5-dien-1-yl)-1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163447349 |
| Molecular Formula | C17H15F3O |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (E)-3-(4-methylcyclohexa-1,5-dien-1-yl)-1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | CC1C=CC(/C=C/C(=O)c2ccccc2C(F)(F)F)=CC1 |
| InChI | InChI=1S/C17H15F3O/c1-12-6-8-13(9-7-12)10-11-16(21)14-4-2-3-5-15(14)17(18,19)20/h2-6,8-12H,7H2,1H3/b11-10+ |
| InChIKey | BDQCICHAHUIAKP-ZHACJKMWSA-N |
| XLogP | 4.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|