C19H14F3NO3 — CID 11674929
(E)-N-hydroxy-3-[4-[(E)-3-oxo-3-[2-(trifluoromethyl)phenyl]prop-1-enyl]phenyl]prop-2-enamide (PubChem CID 11674929) has the molecular formula C19H14F3NO3 and a molecular weight of 361.32 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-[(E)-3-oxo-3-[2-(trifluoromethyl)phenyl]prop-1-enyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-[(E)-3-oxo-3-[2-(trifluoromethyl)phenyl]prop-1-enyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 11674929 |
| Molecular Formula | C19H14F3NO3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (E)-N-hydroxy-3-[4-[(E)-3-oxo-3-[2-(trifluoromethyl)phenyl]prop-1-enyl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(/C=C/C(=O)c2ccccc2C(F)(F)F)cc1)NO |
| InChI | InChI=1S/C19H14F3NO3/c20-19(21,22)16-4-2-1-3-15(16)17(24)11-9-13-5-7-14(8-6-13)10-12-18(25)23-26/h1-12,26H,(H,23,25)/b11-9+,12-10+ |
| InChIKey | PCLQUQXUAWMZFS-WGDLNXRISA-N |
| XLogP | 4.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|