C17H10F6O — CID 146008661
(E)-1-[2,4-bis(trifluoromethyl)phenyl]-3-phenylprop-2-en-1-one (PubChem CID 146008661) has the molecular formula C17H10F6O and a molecular weight of 344.25 g/mol. Its IUPAC name is (E)-1-[2,4-bis(trifluoromethyl)phenyl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[2,4-bis(trifluoromethyl)phenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 146008661 |
| Molecular Formula | C17H10F6O |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | (E)-1-[2,4-bis(trifluoromethyl)phenyl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C17H10F6O/c18-16(19,20)12-7-8-13(14(10-12)17(21,22)23)15(24)9-6-11-4-2-1-3-5-11/h1-10H/b9-6+ |
| InChIKey | DQKGEUVSHIHAJZ-RMKNXTFCSA-N |
| XLogP | 5.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|