C11H9F6NO2 — CID 139245825
1-nitro-4-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]benzene (PubChem CID 139245825) has the molecular formula C11H9F6NO2 and a molecular weight of 301.19 g/mol. Its IUPAC name is 1-nitro-4-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]benzene.
| Compound Name | 1-nitro-4-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]benzene |
|---|---|
| PubChem CID | 139245825 |
| Molecular Formula | C11H9F6NO2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1-nitro-4-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]benzene |
| SMILES | CC(Cc1ccc([N+](=O)[O-])cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H9F6NO2/c1-9(10(12,13)14,11(15,16)17)6-7-2-4-8(5-3-7)18(19)20/h2-5H,6H2,1H3 |
| InChIKey | BBPVXHWERRPXTO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|