C8H7Br2NO4S — CID 66789486
1,1-dibromo-2-(4-nitrophenyl)ethanesulfinic acid (PubChem CID 66789486) has the molecular formula C8H7Br2NO4S and a molecular weight of 373.02 g/mol. Its IUPAC name is 1,1-dibromo-2-(4-nitrophenyl)ethanesulfinic acid.
| Compound Name | 1,1-dibromo-2-(4-nitrophenyl)ethanesulfinic acid |
|---|---|
| PubChem CID | 66789486 |
| Molecular Formula | C8H7Br2NO4S |
| Molecular Weight | 373.02 g/mol |
| Exact Mass | 370.85 |
| IUPAC Name | 1,1-dibromo-2-(4-nitrophenyl)ethanesulfinic acid |
| SMILES | O=[N+]([O-])c1ccc(CC(Br)(Br)S(=O)O)cc1 |
| InChI | InChI=1S/C8H7Br2NO4S/c9-8(10,16(14)15)5-6-1-3-7(4-2-6)11(12)13/h1-4H,5H2,(H,14,15) |
| InChIKey | RXNJIPKYCDGRMV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.02 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|