C11H13Br2NO2 — CID 121221221
1-(2,3-dibromo-2-methylbutyl)-4-nitrobenzene (PubChem CID 121221221) has the molecular formula C11H13Br2NO2 and a molecular weight of 351.04 g/mol. Its IUPAC name is 1-(2,3-dibromo-2-methylbutyl)-4-nitrobenzene.
| Compound Name | 1-(2,3-dibromo-2-methylbutyl)-4-nitrobenzene |
|---|---|
| PubChem CID | 121221221 |
| Molecular Formula | C11H13Br2NO2 |
| Molecular Weight | 351.04 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | 1-(2,3-dibromo-2-methylbutyl)-4-nitrobenzene |
| SMILES | CC(Br)C(C)(Br)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H13Br2NO2/c1-8(12)11(2,13)7-9-3-5-10(6-4-9)14(15)16/h3-6,8H,7H2,1-2H3 |
| InChIKey | IHIJCNWDLJKESQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.04 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|