C13H15NO4 — CID 83154447
2-cyclopropyl-2-methyl-3-(4-nitrophenyl)propanoic acid (PubChem CID 83154447) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-cyclopropyl-2-methyl-3-(4-nitrophenyl)propanoic acid.
| Compound Name | 2-cyclopropyl-2-methyl-3-(4-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 83154447 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-cyclopropyl-2-methyl-3-(4-nitrophenyl)propanoic acid |
| SMILES | CC(Cc1ccc([N+](=O)[O-])cc1)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C13H15NO4/c1-13(12(15)16,10-4-5-10)8-9-2-6-11(7-3-9)14(17)18/h2-3,6-7,10H,4-5,8H2,1H3,(H,15,16) |
| InChIKey | NMEINZGCCNLVDB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|