C8H7F9O2 — CID 170873926
2-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]-1,3-dioxolane (PubChem CID 170873926) has the molecular formula C8H7F9O2 and a molecular weight of 306.12 g/mol. Its IUPAC name is 2-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]-1,3-dioxolane.
| Compound Name | 2-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 170873926 |
| Molecular Formula | C8H7F9O2 |
| Molecular Weight | 306.12 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]-1,3-dioxolane |
| SMILES | FC(F)(F)C(F)(F)C(F)(CC1OCCO1)C(F)(F)F |
| InChI | InChI=1S/C8H7F9O2/c9-5(7(12,13)14,3-4-18-1-2-19-4)6(10,11)8(15,16)17/h4H,1-3H2 |
| InChIKey | SWCXUQAZNHNRHU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.12 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|