C17H23F12I — CID 89292931
1,1,1,2,6,6-hexafluoro-10-iodo-7,7,10-trimethyl-2,4-bis(trifluoromethyl)dodecane (PubChem CID 89292931) has the molecular formula C17H23F12I and a molecular weight of 582.25 g/mol. Its IUPAC name is 1,1,1,2,6,6-hexafluoro-10-iodo-7,7,10-trimethyl-2,4-bis(trifluoromethyl)dodecane.
| Compound Name | 1,1,1,2,6,6-hexafluoro-10-iodo-7,7,10-trimethyl-2,4-bis(trifluoromethyl)dodecane |
|---|---|
| PubChem CID | 89292931 |
| Molecular Formula | C17H23F12I |
| Molecular Weight | 582.25 g/mol |
| Exact Mass | 582.07 |
| IUPAC Name | 1,1,1,2,6,6-hexafluoro-10-iodo-7,7,10-trimethyl-2,4-bis(trifluoromethyl)dodecane |
| SMILES | CCC(C)(I)CCC(C)(C)C(F)(F)CC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H23F12I/c1-5-12(4,30)7-6-11(2,3)14(19,20)9-10(15(21,22)23)8-13(18,16(24,25)26)17(27,28)29/h10H,5-9H2,1-4H3 |
| InChIKey | WONIVKHYPZIVFI-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.25 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|