C8H12F6S — CID 154159165
6,6,6-trifluoro-5-methyl-3-(trifluoromethyl)hexane-1-thiol (PubChem CID 154159165) has the molecular formula C8H12F6S and a molecular weight of 254.24 g/mol. Its IUPAC name is 6,6,6-trifluoro-5-methyl-3-(trifluoromethyl)hexane-1-thiol.
| Compound Name | 6,6,6-trifluoro-5-methyl-3-(trifluoromethyl)hexane-1-thiol |
|---|---|
| PubChem CID | 154159165 |
| Molecular Formula | C8H12F6S |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 6,6,6-trifluoro-5-methyl-3-(trifluoromethyl)hexane-1-thiol |
| SMILES | CC(CC(CCS)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6S/c1-5(7(9,10)11)4-6(2-3-15)8(12,13)14/h5-6,15H,2-4H2,1H3 |
| InChIKey | USPQTKDWBXHFEF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|