C3H10F3N — CID 175460328
azane;methane;1,1,2-trifluoroethane (PubChem CID 175460328) has the molecular formula C3H10F3N and a molecular weight of 117.11 g/mol. Its IUPAC name is azane;methane;1,1,2-trifluoroethane.
| Compound Name | azane;methane;1,1,2-trifluoroethane |
|---|---|
| PubChem CID | 175460328 |
| Molecular Formula | C3H10F3N |
| Molecular Weight | 117.11 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | azane;methane;1,1,2-trifluoroethane |
| SMILES | C.FCC(F)F.N |
| InChI | InChI=1S/C2H3F3.CH4.H3N/c3-1-2(4)5;;/h2H,1H2;1H4;1H3 |
| InChIKey | POKYNACSFARYDH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.11 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |