C7H12F4 — CID 87478513
1,1,7,7-tetrafluoroheptane (PubChem CID 87478513) has the molecular formula C7H12F4 and a molecular weight of 172.16 g/mol. Its IUPAC name is 1,1,7,7-tetrafluoroheptane.
| Compound Name | 1,1,7,7-tetrafluoroheptane |
|---|---|
| PubChem CID | 87478513 |
| Molecular Formula | C7H12F4 |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 1,1,7,7-tetrafluoroheptane |
| SMILES | FC(F)CCCCCC(F)F |
| InChI | InChI=1S/C7H12F4/c8-6(9)4-2-1-3-5-7(10)11/h6-7H,1-5H2 |
| InChIKey | FXFKMPSTPWKVJW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|