C10H23F2NO3S — CID 134207248
8,8-difluorooctane-1-sulfonate;dimethylazanium (PubChem CID 134207248) has the molecular formula C10H23F2NO3S and a molecular weight of 275.36 g/mol. Its IUPAC name is 8,8-difluorooctane-1-sulfonate;dimethylazanium.
| Compound Name | 8,8-difluorooctane-1-sulfonate;dimethylazanium |
|---|---|
| PubChem CID | 134207248 |
| Molecular Formula | C10H23F2NO3S |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 8,8-difluorooctane-1-sulfonate;dimethylazanium |
| SMILES | C[NH2+]C.O=S(=O)([O-])CCCCCCCC(F)F |
| InChI | InChI=1S/C8H16F2O3S.C2H7N/c9-8(10)6-4-2-1-3-5-7-14(11,12)13;1-3-2/h8H,1-7H2,(H,11,12,13);3H,1-2H3 |
| InChIKey | XEERLQADIZKJSM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|