About dimethylazanium;pentane-1-sulfonate
dimethylazanium;pentane-1-sulfonate (PubChem CID 122481233) has the molecular formula C7H19NO3S
and a molecular weight of 197.30 g/mol. Its IUPAC name is dimethylazanium;pentane-1-sulfonate.
Molecular Properties
| Compound Name | dimethylazanium;pentane-1-sulfonate |
| PubChem CID | 122481233 |
| Molecular Formula | C7H19NO3S |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | dimethylazanium;pentane-1-sulfonate |
| SMILES | CCCCCS(=O)(=O)[O-].C[NH2+]C |
| InChI | InChI=1S/C5H12O3S.C2H7N/c1-2-3-4-5-9(6,7)8;1-3-2/h2-5H2,1H3,(H,6,7,8);3H,1-2H3 |
| InChIKey | WFZWYPJKGBQRMS-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dimethylazanium;pentane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylazanium;pentane-1-sulfonate?
The IUPAC name of dimethylazanium;pentane-1-sulfonate (CID 122481233) is dimethylazanium;pentane-1-sulfonate.
What is the SMILES notation for dimethylazanium;pentane-1-sulfonate?
The canonical SMILES for dimethylazanium;pentane-1-sulfonate is CCCCCS(=O)(=O)[O-].C[NH2+]C.
What is the InChIKey of dimethylazanium;pentane-1-sulfonate?
The InChIKey is WFZWYPJKGBQRMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O3S.C2H7N/c1-2-3-4-5-9(6,7)8;1-3-2/h2-5H2,1H3,(H,6,7,8);3H,1-2H3.
What are the key properties of dimethylazanium;pentane-1-sulfonate?
dimethylazanium;pentane-1-sulfonate has a molecular weight of 197.30 g/mol, XLogP of -0.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylazanium;pentane-1-sulfonate is sourced from PubChem (CID 122481233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).