C6H15F2NO3S — CID 134206809
4,4-difluorobutane-1-sulfonate;dimethylazanium (PubChem CID 134206809) has the molecular formula C6H15F2NO3S and a molecular weight of 219.25 g/mol. Its IUPAC name is 4,4-difluorobutane-1-sulfonate;dimethylazanium.
| Compound Name | 4,4-difluorobutane-1-sulfonate;dimethylazanium |
|---|---|
| PubChem CID | 134206809 |
| Molecular Formula | C6H15F2NO3S |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 4,4-difluorobutane-1-sulfonate;dimethylazanium |
| SMILES | C[NH2+]C.O=S(=O)([O-])CCCC(F)F |
| InChI | InChI=1S/C4H8F2O3S.C2H7N/c5-4(6)2-1-3-10(7,8)9;1-3-2/h4H,1-3H2,(H,7,8,9);3H,1-2H3 |
| InChIKey | KHUONZQDMQPBNP-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|