C6H15F2NO3S — CID 134207381
azanium 6,6-difluorohexane-1-sulfonate (PubChem CID 134207381) has the molecular formula C6H15F2NO3S and a molecular weight of 219.25 g/mol. Its IUPAC name is azanium 6,6-difluorohexane-1-sulfonate.
| Compound Name | azanium 6,6-difluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 134207381 |
| Molecular Formula | C6H15F2NO3S |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | azanium 6,6-difluorohexane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCCCC(F)F.[NH4+] |
| InChI | InChI=1S/C6H12F2O3S.H3N/c7-6(8)4-2-1-3-5-12(9,10)11;/h6H,1-5H2,(H,9,10,11);1H3 |
| InChIKey | UCVIMUGAFRXKCJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|