C13H27F5Si2 — CID 154510816
6-(7,7-difluoroheptylsilyl)hexyl-trifluorosilane (PubChem CID 154510816) has the molecular formula C13H27F5Si2 and a molecular weight of 334.52 g/mol. Its IUPAC name is 6-(7,7-difluoroheptylsilyl)hexyl-trifluorosilane.
| Compound Name | 6-(7,7-difluoroheptylsilyl)hexyl-trifluorosilane |
|---|---|
| PubChem CID | 154510816 |
| Molecular Formula | C13H27F5Si2 |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 6-(7,7-difluoroheptylsilyl)hexyl-trifluorosilane |
| SMILES | FC(F)CCCCCC[SiH2]CCCCCC[Si](F)(F)F |
| InChI | InChI=1S/C13H27F5Si2/c14-13(15)9-5-1-2-6-10-19-11-7-3-4-8-12-20(16,17)18/h13H,1-12,19H2 |
| InChIKey | HFSGFTXPHWUAGU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|