C15H32F4Si2 — CID 154510794
5,5-difluoropentyl-[4-(5,5-difluoropentylsilyl)-2-methylbutyl]silane (PubChem CID 154510794) has the molecular formula C15H32F4Si2 and a molecular weight of 344.59 g/mol. Its IUPAC name is 5,5-difluoropentyl-[4-(5,5-difluoropentylsilyl)-2-methylbutyl]silane.
| Compound Name | 5,5-difluoropentyl-[4-(5,5-difluoropentylsilyl)-2-methylbutyl]silane |
|---|---|
| PubChem CID | 154510794 |
| Molecular Formula | C15H32F4Si2 |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 5,5-difluoropentyl-[4-(5,5-difluoropentylsilyl)-2-methylbutyl]silane |
| SMILES | CC(CC[SiH2]CCCCC(F)F)C[SiH2]CCCCC(F)F |
| InChI | InChI=1S/C15H32F4Si2/c1-13(12-21-10-5-3-7-15(18)19)8-11-20-9-4-2-6-14(16)17/h13-15H,2-12,20-21H2,1H3 |
| InChIKey | DAONHTILPBJWOP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|