C8H18Cl4Si2 — CID 123506218
2,2-dichloroethyl-[4-(2,2-dichloroethylsilyl)butyl]silane (PubChem CID 123506218) has the molecular formula C8H18Cl4Si2 and a molecular weight of 312.22 g/mol. Its IUPAC name is 2,2-dichloroethyl-[4-(2,2-dichloroethylsilyl)butyl]silane.
| Compound Name | 2,2-dichloroethyl-[4-(2,2-dichloroethylsilyl)butyl]silane |
|---|---|
| PubChem CID | 123506218 |
| Molecular Formula | C8H18Cl4Si2 |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 2,2-dichloroethyl-[4-(2,2-dichloroethylsilyl)butyl]silane |
| SMILES | ClC(Cl)C[SiH2]CCCC[SiH2]CC(Cl)Cl |
| InChI | InChI=1S/C8H18Cl4Si2/c9-7(10)5-13-3-1-2-4-14-6-8(11)12/h7-8H,1-6,13-14H2 |
| InChIKey | COFPOXMUUMBFEK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|