About 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane
2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane (PubChem CID 154510766) has the molecular formula C7H15F5Si2
and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane.
Molecular Properties
| Compound Name | 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane |
| PubChem CID | 154510766 |
| Molecular Formula | C7H15F5Si2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane |
| SMILES | FC(F)CCCC[SiH2]CC[Si](F)(F)F |
| InChI | InChI=1S/C7H15F5Si2/c8-7(9)3-1-2-4-13-5-6-14(10,11)12/h7H,1-6,13H2 |
| InChIKey | CFZFMDQIXCWNSU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane?
The IUPAC name of 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane (CID 154510766) is 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane.
What is the SMILES notation for 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane?
The canonical SMILES for 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane is FC(F)CCCC[SiH2]CC[Si](F)(F)F.
What is the InChIKey of 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane?
The InChIKey is CFZFMDQIXCWNSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F5Si2/c8-7(9)3-1-2-4-13-5-6-14(10,11)12/h7H,1-6,13H2.
What are the key properties of 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane?
2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane has a molecular weight of 250.36 g/mol, XLogP of 3.27, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-difluoropentylsilyl)ethyl-trifluorosilane is sourced from PubChem (CID 154510766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).