About 4,4-difluorobutylhydrazine;dihydrochloride
4,4-difluorobutylhydrazine;dihydrochloride (PubChem CID 146082170) has the molecular formula C4H12Cl2F2N2
and a molecular weight of 197.06 g/mol. Its IUPAC name is 4,4-difluorobutylhydrazine;dihydrochloride.
Molecular Properties
| Compound Name | 4,4-difluorobutylhydrazine;dihydrochloride |
| PubChem CID | 146082170 |
| Molecular Formula | C4H12Cl2F2N2 |
| Molecular Weight | 197.06 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 4,4-difluorobutylhydrazine;dihydrochloride |
| SMILES | Cl.Cl.NNCCCC(F)F |
| InChI | InChI=1S/C4H10F2N2.2ClH/c5-4(6)2-1-3-8-7;;/h4,8H,1-3,7H2;2*1H |
| InChIKey | GWMSVNOSMAFCJE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.06 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluorobutylhydrazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluorobutylhydrazine;dihydrochloride?
The IUPAC name of 4,4-difluorobutylhydrazine;dihydrochloride (CID 146082170) is 4,4-difluorobutylhydrazine;dihydrochloride.
What is the SMILES notation for 4,4-difluorobutylhydrazine;dihydrochloride?
The canonical SMILES for 4,4-difluorobutylhydrazine;dihydrochloride is Cl.Cl.NNCCCC(F)F.
What is the InChIKey of 4,4-difluorobutylhydrazine;dihydrochloride?
The InChIKey is GWMSVNOSMAFCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10F2N2.2ClH/c5-4(6)2-1-3-8-7;;/h4,8H,1-3,7H2;2*1H.
What are the key properties of 4,4-difluorobutylhydrazine;dihydrochloride?
4,4-difluorobutylhydrazine;dihydrochloride has a molecular weight of 197.06 g/mol, XLogP of 1.34, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluorobutylhydrazine;dihydrochloride is sourced from PubChem (CID 146082170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).