About 3-butylheptylhydrazine
3-butylheptylhydrazine (PubChem CID 142680848) has the molecular formula C11H26N2
and a molecular weight of 186.34 g/mol. Its IUPAC name is 3-butylheptylhydrazine.
Molecular Properties
| Compound Name | 3-butylheptylhydrazine |
| PubChem CID | 142680848 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | 3-butylheptylhydrazine |
| SMILES | CCCCC(CCCC)CCNN |
| InChI | InChI=1S/C11H26N2/c1-3-5-7-11(8-6-4-2)9-10-13-12/h11,13H,3-10,12H2,1-2H3 |
| InChIKey | HJMMDXKKDPMGGX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-butylheptylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylheptylhydrazine?
The IUPAC name of 3-butylheptylhydrazine (CID 142680848) is 3-butylheptylhydrazine.
What is the SMILES notation for 3-butylheptylhydrazine?
The canonical SMILES for 3-butylheptylhydrazine is CCCCC(CCCC)CCNN.
What is the InChIKey of 3-butylheptylhydrazine?
The InChIKey is HJMMDXKKDPMGGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2/c1-3-5-7-11(8-6-4-2)9-10-13-12/h11,13H,3-10,12H2,1-2H3.
What are the key properties of 3-butylheptylhydrazine?
3-butylheptylhydrazine has a molecular weight of 186.34 g/mol, XLogP of 2.84, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylheptylhydrazine is sourced from PubChem (CID 142680848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).