C6H11F4N — CID 12032290
N-(3,3-difluoropropyl)-3,3-difluoropropan-1-amine (PubChem CID 12032290) has the molecular formula C6H11F4N and a molecular weight of 173.15 g/mol. Its IUPAC name is N-(3,3-difluoropropyl)-3,3-difluoropropan-1-amine.
| Compound Name | N-(3,3-difluoropropyl)-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 12032290 |
| Molecular Formula | C6H11F4N |
| Molecular Weight | 173.15 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | N-(3,3-difluoropropyl)-3,3-difluoropropan-1-amine |
| SMILES | FC(F)CCNCCC(F)F |
| InChI | InChI=1S/C6H11F4N/c7-5(8)1-3-11-4-2-6(9)10/h5-6,11H,1-4H2 |
| InChIKey | LLVMEINJTMCRKG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|