C15H25F2N3 — CID 153342691
6-[4-(3,3-difluoropropylamino)butyl]-3-ethyl-N-methylpyridin-2-amine (PubChem CID 153342691) has the molecular formula C15H25F2N3 and a molecular weight of 285.38 g/mol. Its IUPAC name is 6-[4-(3,3-difluoropropylamino)butyl]-3-ethyl-N-methylpyridin-2-amine.
| Compound Name | 6-[4-(3,3-difluoropropylamino)butyl]-3-ethyl-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 153342691 |
| Molecular Formula | C15H25F2N3 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 6-[4-(3,3-difluoropropylamino)butyl]-3-ethyl-N-methylpyridin-2-amine |
| SMILES | CCc1ccc(CCCCNCCC(F)F)nc1NC |
| InChI | InChI=1S/C15H25F2N3/c1-3-12-7-8-13(20-15(12)18-2)6-4-5-10-19-11-9-14(16)17/h7-8,14,19H,3-6,9-11H2,1-2H3,(H,18,20) |
| InChIKey | HKAZORJHNVKMQW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|