C18H34N4O — CID 153342726
ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide (PubChem CID 153342726) has the molecular formula C18H34N4O and a molecular weight of 322.50 g/mol. Its IUPAC name is ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide.
| Compound Name | ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 153342726 |
| Molecular Formula | C18H34N4O |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide |
| SMILES | CC.CCc1ccc(CCCCNCCNC(C)=O)nc1NC |
| InChI | InChI=1S/C16H28N4O.C2H6/c1-4-14-8-9-15(20-16(14)17-3)7-5-6-10-18-11-12-19-13(2)21;1-2/h8-9,18H,4-7,10-12H2,1-3H3,(H,17,20)(H,19,21);1-2H3 |
| InChIKey | JHFKHDUCLVHEIB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|