About ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide
ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide (PubChem CID 153342726) has the molecular formula C18H34N4O
and a molecular weight of 322.50 g/mol. Its IUPAC name is ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide.
Molecular Properties
| Compound Name | ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide |
| PubChem CID | 153342726 |
| Molecular Formula | C18H34N4O |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide |
| SMILES | CC.CCc1ccc(CCCCNCCNC(C)=O)nc1NC |
| InChI | InChI=1S/C16H28N4O.C2H6/c1-4-14-8-9-15(20-16(14)17-3)7-5-6-10-18-11-12-19-13(2)21;1-2/h8-9,18H,4-7,10-12H2,1-3H3,(H,17,20)(H,19,21);1-2H3 |
| InChIKey | JHFKHDUCLVHEIB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide?
The IUPAC name of ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide (CID 153342726) is ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide.
What is the SMILES notation for ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide?
The canonical SMILES for ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide is CC.CCc1ccc(CCCCNCCNC(C)=O)nc1NC.
What is the InChIKey of ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide?
The InChIKey is JHFKHDUCLVHEIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N4O.C2H6/c1-4-14-8-9-15(20-16(14)17-3)7-5-6-10-18-11-12-19-13(2)21;1-2/h8-9,18H,4-7,10-12H2,1-3H3,(H,17,20)(H,19,21);1-2H3.
What are the key properties of ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide?
ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide has a molecular weight of 322.50 g/mol, XLogP of 2.76, 10 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[2-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butylamino]ethyl]acetamide is sourced from PubChem (CID 153342726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).