C21H36N3O2Y- — CID 171832856
cyclobutane;[5-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butoxy]-2-hydroxypent-1-en-3-yl]azanide;yttrium (PubChem CID 171832856) has the molecular formula C21H36N3O2Y- and a molecular weight of 451.44 g/mol. Its IUPAC name is cyclobutane;[5-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butoxy]-2-hydroxypent-1-en-3-yl]azanide;yttrium.
| Compound Name | cyclobutane;[5-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butoxy]-2-hydroxypent-1-en-3-yl]azanide;yttrium |
|---|---|
| PubChem CID | 171832856 |
| Molecular Formula | C21H36N3O2Y- |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | cyclobutane;[5-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butoxy]-2-hydroxypent-1-en-3-yl]azanide;yttrium |
| SMILES | C1CCC1.C=C(O)C([NH-])CCOCCCCc1ccc(CC)c(NC)n1.[Y] |
| InChI | InChI=1S/C17H28N3O2.C4H8.Y/c1-4-14-8-9-15(20-17(14)19-3)7-5-6-11-22-12-10-16(18)13(2)21;1-2-4-3-1;/h8-9,16,18,21H,2,4-7,10-12H2,1,3H3,(H,19,20);1-4H2;/q-1;; |
| InChIKey | BOUHLYHWYGOAHC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 78.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|