C28H45ClN4O4 — CID 171833194
2-[[1-[[(E)-1-chloro-3,4-dimethylhex-1-enyl]amino]cyclopropanecarbonyl]amino]-4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butoxy]butanoic acid (PubChem CID 171833194) has the molecular formula C28H45ClN4O4 and a molecular weight of 537.15 g/mol. Its IUPAC name is 2-[[1-[[(E)-1-chloro-3,4-dimethylhex-1-enyl]amino]cyclopropanecarbonyl]amino]-4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butoxy]butanoic acid.
| Compound Name | 2-[[1-[[(E)-1-chloro-3,4-dimethylhex-1-enyl]amino]cyclopropanecarbonyl]amino]-4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butoxy]butanoic acid |
|---|---|
| PubChem CID | 171833194 |
| Molecular Formula | C28H45ClN4O4 |
| Molecular Weight | 537.15 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | 2-[[1-[[(E)-1-chloro-3,4-dimethylhex-1-enyl]amino]cyclopropanecarbonyl]amino]-4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butoxy]butanoic acid |
| SMILES | CCc1ccc(CCCCOCCC(NC(=O)C2(N/C(Cl)=C\C(C)C(C)CC)CC2)C(=O)O)nc1NC |
| InChI | InChI=1S/C28H45ClN4O4/c1-6-19(3)20(4)18-24(29)33-28(14-15-28)27(36)32-23(26(34)35)13-17-37-16-9-8-10-22-12-11-21(7-2)25(30-5)31-22/h11-12,18-20,23,33H,6-10,13-17H2,1-5H3,(H,30,31)(H,32,36)(H,34,35)/b24-18- |
| InChIKey | XJHYTDFCLGWTRS-MOHJPFBDSA-N |
| XLogP | 4.87 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.15 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|